About [heptylsulfanyl(2-methylpropoxy)phosphoryl]sulfanylbenzene;zinc
[heptylsulfanyl(2-methylpropoxy)phosphoryl]sulfanylbenzene;zinc (PubChem CID 67861989) has the molecular formula C17H29O2PS2Zn
and a molecular weight of 425.92 g/mol. Its IUPAC name is [heptylsulfanyl(2-methylpropoxy)phosphoryl]sulfanylbenzene;zinc.
Molecular Properties
| Compound Name | [heptylsulfanyl(2-methylpropoxy)phosphoryl]sulfanylbenzene;zinc |
| PubChem CID | 67861989 |
| Molecular Formula | C17H29O2PS2Zn |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | [heptylsulfanyl(2-methylpropoxy)phosphoryl]sulfanylbenzene;zinc |
| SMILES | CCCCCCCSP(=O)(OCC(C)C)Sc1ccccc1.[Zn] |
| InChI | InChI=1S/C17H29O2PS2.Zn/c1-4-5-6-7-11-14-21-20(18,19-15-16(2)3)22-17-12-9-8-10-13-17;/h8-10,12-13,16H,4-7,11,14-15H2,1-3H3; |
| InChIKey | MNYZKGXNLSFSPS-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [heptylsulfanyl(2-methylpropoxy)phosphoryl]sulfanylbenzene;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [heptylsulfanyl(2-methylpropoxy)phosphoryl]sulfanylbenzene;zinc?
The IUPAC name of [heptylsulfanyl(2-methylpropoxy)phosphoryl]sulfanylbenzene;zinc (CID 67861989) is [heptylsulfanyl(2-methylpropoxy)phosphoryl]sulfanylbenzene;zinc.
What is the SMILES notation for [heptylsulfanyl(2-methylpropoxy)phosphoryl]sulfanylbenzene;zinc?
The canonical SMILES for [heptylsulfanyl(2-methylpropoxy)phosphoryl]sulfanylbenzene;zinc is CCCCCCCSP(=O)(OCC(C)C)Sc1ccccc1.[Zn].
What is the InChIKey of [heptylsulfanyl(2-methylpropoxy)phosphoryl]sulfanylbenzene;zinc?
The InChIKey is MNYZKGXNLSFSPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29O2PS2.Zn/c1-4-5-6-7-11-14-21-20(18,19-15-16(2)3)22-17-12-9-8-10-13-17;/h8-10,12-13,16H,4-7,11,14-15H2,1-3H3;.
What are the key properties of [heptylsulfanyl(2-methylpropoxy)phosphoryl]sulfanylbenzene;zinc?
[heptylsulfanyl(2-methylpropoxy)phosphoryl]sulfanylbenzene;zinc has a molecular weight of 425.92 g/mol, XLogP of 7.26, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [heptylsulfanyl(2-methylpropoxy)phosphoryl]sulfanylbenzene;zinc is sourced from PubChem (CID 67861989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).