C19H13N5O5 — CID 67862147
1-(2-nitrophenyl)-3-[(4-oxo-3H-pyridin-2-yl)methyl]pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 67862147) has the molecular formula C19H13N5O5 and a molecular weight of 391.34 g/mol. Its IUPAC name is 1-(2-nitrophenyl)-3-[(4-oxo-3H-pyridin-2-yl)methyl]pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-(2-nitrophenyl)-3-[(4-oxo-3H-pyridin-2-yl)methyl]pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67862147 |
| Molecular Formula | C19H13N5O5 |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 1-(2-nitrophenyl)-3-[(4-oxo-3H-pyridin-2-yl)methyl]pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | O=C1C=CN=C(Cn2c(=O)c3cccnc3n(-c3ccccc3[N+](=O)[O-])c2=O)C1 |
| InChI | InChI=1S/C19H13N5O5/c25-13-7-9-20-12(10-13)11-22-18(26)14-4-3-8-21-17(14)23(19(22)27)15-5-1-2-6-16(15)24(28)29/h1-9H,10-11H2 |
| InChIKey | CJHQAPIYNOEKLE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 129.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|