C13H20N4O3 — CID 67862274
N-[4-(2,3-dihydroxypropyl)piperazin-1-yl]pyridine-3-carboxamide (PubChem CID 67862274) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is N-[4-(2,3-dihydroxypropyl)piperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | N-[4-(2,3-dihydroxypropyl)piperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67862274 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | N-[4-(2,3-dihydroxypropyl)piperazin-1-yl]pyridine-3-carboxamide |
| SMILES | O=C(NN1CCN(CC(O)CO)CC1)c1cccnc1 |
| InChI | InChI=1S/C13H20N4O3/c18-10-12(19)9-16-4-6-17(7-5-16)15-13(20)11-2-1-3-14-8-11/h1-3,8,12,18-19H,4-7,9-10H2,(H,15,20) |
| InChIKey | ICHFDFYIRRCWSV-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |