C10H10N4O3 — CID 6502102
N-(2,4-dioxo-1,3-diazinan-1-yl)pyridine-3-carboxamide (PubChem CID 6502102) has the molecular formula C10H10N4O3 and a molecular weight of 234.22 g/mol. Its IUPAC name is N-(2,4-dioxo-1,3-diazinan-1-yl)pyridine-3-carboxamide.
| Compound Name | N-(2,4-dioxo-1,3-diazinan-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6502102 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | N-(2,4-dioxo-1,3-diazinan-1-yl)pyridine-3-carboxamide |
| SMILES | O=C1CCN(NC(=O)c2cccnc2)C(=O)N1 |
| InChI | InChI=1S/C10H10N4O3/c15-8-3-5-14(10(17)12-8)13-9(16)7-2-1-4-11-6-7/h1-2,4,6H,3,5H2,(H,13,16)(H,12,15,17) |
| InChIKey | ZYSRALGTZPOMAX-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |