About S-(2-oxoazetidin-1-yl) pyridine-3-carbothioate
S-(2-oxoazetidin-1-yl) pyridine-3-carbothioate (PubChem CID 158660231) has the molecular formula C9H8N2O2S
and a molecular weight of 208.24 g/mol. Its IUPAC name is S-(2-oxoazetidin-1-yl) pyridine-3-carbothioate.
Molecular Properties
| Compound Name | S-(2-oxoazetidin-1-yl) pyridine-3-carbothioate |
| PubChem CID | 158660231 |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | S-(2-oxoazetidin-1-yl) pyridine-3-carbothioate |
| SMILES | O=C(SN1CCC1=O)c1cccnc1 |
| InChI | InChI=1S/C9H8N2O2S/c12-8-3-5-11(8)14-9(13)7-2-1-4-10-6-7/h1-2,4,6H,3,5H2 |
| InChIKey | ICQVTWUSCNJVGS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-oxoazetidin-1-yl) pyridine-3-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-oxoazetidin-1-yl) pyridine-3-carbothioate?
The IUPAC name of S-(2-oxoazetidin-1-yl) pyridine-3-carbothioate (CID 158660231) is S-(2-oxoazetidin-1-yl) pyridine-3-carbothioate.
What is the SMILES notation for S-(2-oxoazetidin-1-yl) pyridine-3-carbothioate?
The canonical SMILES for S-(2-oxoazetidin-1-yl) pyridine-3-carbothioate is O=C(SN1CCC1=O)c1cccnc1.
What is the InChIKey of S-(2-oxoazetidin-1-yl) pyridine-3-carbothioate?
The InChIKey is ICQVTWUSCNJVGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2S/c12-8-3-5-11(8)14-9(13)7-2-1-4-10-6-7/h1-2,4,6H,3,5H2.
What are the key properties of S-(2-oxoazetidin-1-yl) pyridine-3-carbothioate?
S-(2-oxoazetidin-1-yl) pyridine-3-carbothioate has a molecular weight of 208.24 g/mol, XLogP of 1.10, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-oxoazetidin-1-yl) pyridine-3-carbothioate is sourced from PubChem (CID 158660231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).