C12H14N2O2 — CID 114499676
3-methyl-1-(pyridine-3-carbonyl)piperidin-4-one (PubChem CID 114499676) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-methyl-1-(pyridine-3-carbonyl)piperidin-4-one.
| Compound Name | 3-methyl-1-(pyridine-3-carbonyl)piperidin-4-one |
|---|---|
| PubChem CID | 114499676 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 3-methyl-1-(pyridine-3-carbonyl)piperidin-4-one |
| SMILES | CC1CN(C(=O)c2cccnc2)CCC1=O |
| InChI | InChI=1S/C12H14N2O2/c1-9-8-14(6-4-11(9)15)12(16)10-3-2-5-13-7-10/h2-3,5,7,9H,4,6,8H2,1H3 |
| InChIKey | FWUZJWYYYZAXEX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |