C30H45N3O3S — CID 67863955
N-butyl-3-[(4-decoxyphenyl)carbamoylamino]-4-ethylsulfanylbenzamide (PubChem CID 67863955) has the molecular formula C30H45N3O3S and a molecular weight of 527.78 g/mol. Its IUPAC name is N-butyl-3-[(4-decoxyphenyl)carbamoylamino]-4-ethylsulfanylbenzamide.
| Compound Name | N-butyl-3-[(4-decoxyphenyl)carbamoylamino]-4-ethylsulfanylbenzamide |
|---|---|
| PubChem CID | 67863955 |
| Molecular Formula | C30H45N3O3S |
| Molecular Weight | 527.78 g/mol |
| Exact Mass | 527.32 |
| IUPAC Name | N-butyl-3-[(4-decoxyphenyl)carbamoylamino]-4-ethylsulfanylbenzamide |
| SMILES | CCCCCCCCCCOc1ccc(NC(=O)Nc2cc(C(=O)NCCCC)ccc2SCC)cc1 |
| InChI | InChI=1S/C30H45N3O3S/c1-4-7-9-10-11-12-13-14-22-36-26-18-16-25(17-19-26)32-30(35)33-27-23-24(15-20-28(27)37-6-3)29(34)31-21-8-5-2/h15-20,23H,4-14,21-22H2,1-3H3,(H,31,34)(H2,32,33,35) |
| InChIKey | JHVLKIDVXRUCAJ-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.78 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|