C18H27ClN2O2S — CID 54567207
N-butyl-3-(5-chloropentanoylamino)-4-ethylsulfanylbenzamide (PubChem CID 54567207) has the molecular formula C18H27ClN2O2S and a molecular weight of 370.95 g/mol. Its IUPAC name is N-butyl-3-(5-chloropentanoylamino)-4-ethylsulfanylbenzamide.
| Compound Name | N-butyl-3-(5-chloropentanoylamino)-4-ethylsulfanylbenzamide |
|---|---|
| PubChem CID | 54567207 |
| Molecular Formula | C18H27ClN2O2S |
| Molecular Weight | 370.95 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-butyl-3-(5-chloropentanoylamino)-4-ethylsulfanylbenzamide |
| SMILES | CCCCNC(=O)c1ccc(SCC)c(NC(=O)CCCCCl)c1 |
| InChI | InChI=1S/C18H27ClN2O2S/c1-3-5-12-20-18(23)14-9-10-16(24-4-2)15(13-14)21-17(22)8-6-7-11-19/h9-10,13H,3-8,11-12H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | ZURKIBHQBORESF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.95 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|