C18H27ClN2OS2 — CID 57208009
5-chloro-N-[2-ethyl-5-(3-methylsulfanylpropylcarbamothioyl)phenyl]pentanamide (PubChem CID 57208009) has the molecular formula C18H27ClN2OS2 and a molecular weight of 387.01 g/mol. Its IUPAC name is 5-chloro-N-[2-ethyl-5-(3-methylsulfanylpropylcarbamothioyl)phenyl]pentanamide.
| Compound Name | 5-chloro-N-[2-ethyl-5-(3-methylsulfanylpropylcarbamothioyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 57208009 |
| Molecular Formula | C18H27ClN2OS2 |
| Molecular Weight | 387.01 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 5-chloro-N-[2-ethyl-5-(3-methylsulfanylpropylcarbamothioyl)phenyl]pentanamide |
| SMILES | CCc1ccc(C(=S)NCCCSC)cc1NC(=O)CCCCCl |
| InChI | InChI=1S/C18H27ClN2OS2/c1-3-14-8-9-15(18(23)20-11-6-12-24-2)13-16(14)21-17(22)7-4-5-10-19/h8-9,13H,3-7,10-12H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | HBEMRLLWMBMFFF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.01 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|