C17H25ClN2OS2 — CID 88500918
4-chloro-N-[2-ethyl-5-(3-methylsulfanylpropylcarbamothioyl)phenyl]butanamide (PubChem CID 88500918) has the molecular formula C17H25ClN2OS2 and a molecular weight of 372.99 g/mol. Its IUPAC name is 4-chloro-N-[2-ethyl-5-(3-methylsulfanylpropylcarbamothioyl)phenyl]butanamide.
| Compound Name | 4-chloro-N-[2-ethyl-5-(3-methylsulfanylpropylcarbamothioyl)phenyl]butanamide |
|---|---|
| PubChem CID | 88500918 |
| Molecular Formula | C17H25ClN2OS2 |
| Molecular Weight | 372.99 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 4-chloro-N-[2-ethyl-5-(3-methylsulfanylpropylcarbamothioyl)phenyl]butanamide |
| SMILES | CCc1ccc(C(=S)NCCCSC)cc1NC(=O)CCCCl |
| InChI | InChI=1S/C17H25ClN2OS2/c1-3-13-7-8-14(17(22)19-10-5-11-23-2)12-15(13)20-16(21)6-4-9-18/h7-8,12H,3-6,9-11H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | VFRMPBHRYSLQAH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.99 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|