C25H38O5 — CID 67865282
[(8R,9R,10S,13S,14S)-17-acetyloxy-15-ethyl-10-(hydroxymethyl)-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 67865282) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is [(8R,9R,10S,13S,14S)-17-acetyloxy-15-ethyl-10-(hydroxymethyl)-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8R,9R,10S,13S,14S)-17-acetyloxy-15-ethyl-10-(hydroxymethyl)-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 67865282 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | [(8R,9R,10S,13S,14S)-17-acetyloxy-15-ethyl-10-(hydroxymethyl)-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CCC1CC(OC(C)=O)[C@@]2(C)CC[C@@H]3[C@@H](CC=C4CC(OC(C)=O)CC[C@@]43CO)[C@H]12 |
| InChI | InChI=1S/C25H38O5/c1-5-17-12-22(30-16(3)28)24(4)10-9-21-20(23(17)24)7-6-18-13-19(29-15(2)27)8-11-25(18,21)14-26/h6,17,19-23,26H,5,7-14H2,1-4H3/t17?,19?,20-,21-,22?,23+,24-,25-/m1/s1 |
| InChIKey | VNZBYBAMNLSUAA-NPXVFHMUSA-N |
| XLogP | 4.42 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|