C19H24N2O3S — CID 67867624
7-[1-amino-7-(5-methylfuran-2-yl)heptyl]-4-hydroxy-3H-1,3-benzothiazol-2-one (PubChem CID 67867624) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is 7-[1-amino-7-(5-methylfuran-2-yl)heptyl]-4-hydroxy-3H-1,3-benzothiazol-2-one.
| Compound Name | 7-[1-amino-7-(5-methylfuran-2-yl)heptyl]-4-hydroxy-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 67867624 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 7-[1-amino-7-(5-methylfuran-2-yl)heptyl]-4-hydroxy-3H-1,3-benzothiazol-2-one |
| SMILES | Cc1ccc(CCCCCCC(N)c2ccc(O)c3[nH]c(=O)sc23)o1 |
| InChI | InChI=1S/C19H24N2O3S/c1-12-8-9-13(24-12)6-4-2-3-5-7-15(20)14-10-11-16(22)17-18(14)25-19(23)21-17/h8-11,15,22H,2-7,20H2,1H3,(H,21,23) |
| InChIKey | HWQOFUPYKTXYJF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 92.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|