C33H52O5 — CID 67868321
(4aS,6aR,6aS,6bR,10S,12aR,14bR)-10-(2-carboxyethoxy)-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carboxylic acid (PubChem CID 67868321) has the molecular formula C33H52O5 and a molecular weight of 528.77 g/mol. Its IUPAC name is (4aS,6aR,6aS,6bR,10S,12aR,14bR)-10-(2-carboxyethoxy)-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carboxylic acid.
| Compound Name | (4aS,6aR,6aS,6bR,10S,12aR,14bR)-10-(2-carboxyethoxy)-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carboxylic acid |
|---|---|
| PubChem CID | 67868321 |
| Molecular Formula | C33H52O5 |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | (4aS,6aR,6aS,6bR,10S,12aR,14bR)-10-(2-carboxyethoxy)-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carboxylic acid |
| SMILES | CC1(C(=O)O)CC[C@]2(C)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](OCCC(=O)O)C(C)(C)C5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C33H52O5/c1-28(2)23-10-14-33(7)24(31(23,5)13-11-25(28)38-19-12-26(34)35)9-8-21-22-20-30(4,27(36)37)16-15-29(22,3)17-18-32(21,33)6/h8,22-25H,9-20H2,1-7H3,(H,34,35)(H,36,37)/t22-,23?,24+,25-,29+,30?,31-,32+,33+/m0/s1 |
| InChIKey | CWCGOLFDVGIUOR-GANWPVNRSA-N |
| XLogP | 7.73 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|