C36H44N2O7S — CID 67868448
2-[2-[6-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-2-naphthalen-1-yl-5-oxo-1,4-thiazepan-4-yl]acetyl]oxyethyl 2,2-dimethylpropanoate (PubChem CID 67868448) has the molecular formula C36H44N2O7S and a molecular weight of 648.82 g/mol. Its IUPAC name is 2-[2-[6-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-2-naphthalen-1-yl-5-oxo-1,4-thiazepan-4-yl]acetyl]oxyethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[2-[6-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-2-naphthalen-1-yl-5-oxo-1,4-thiazepan-4-yl]acetyl]oxyethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 67868448 |
| Molecular Formula | C36H44N2O7S |
| Molecular Weight | 648.82 g/mol |
| Exact Mass | 648.29 |
| IUPAC Name | 2-[2-[6-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-2-naphthalen-1-yl-5-oxo-1,4-thiazepan-4-yl]acetyl]oxyethyl 2,2-dimethylpropanoate |
| SMILES | CCOC(=O)C(CCc1ccccc1)NC1CSC(c2cccc3ccccc23)CN(CC(=O)OCCOC(=O)C(C)(C)C)C1=O |
| InChI | InChI=1S/C36H44N2O7S/c1-5-43-34(41)29(19-18-25-12-7-6-8-13-25)37-30-24-46-31(28-17-11-15-26-14-9-10-16-27(26)28)22-38(33(30)40)23-32(39)44-20-21-45-35(42)36(2,3)4/h6-17,29-31,37H,5,18-24H2,1-4H3 |
| InChIKey | JVSIJQNETMRYPD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.82 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|