C30H33FN6 — CID 67870742
5-[2-[4-[[4-fluoro-5-(3-methylbutyl)-3-(2-phenylethyl)-2H-imidazol-1-yl]methyl]phenyl]phenyl]-2H-tetrazole (PubChem CID 67870742) has the molecular formula C30H33FN6 and a molecular weight of 496.63 g/mol. Its IUPAC name is 5-[2-[4-[[4-fluoro-5-(3-methylbutyl)-3-(2-phenylethyl)-2H-imidazol-1-yl]methyl]phenyl]phenyl]-2H-tetrazole.
| Compound Name | 5-[2-[4-[[4-fluoro-5-(3-methylbutyl)-3-(2-phenylethyl)-2H-imidazol-1-yl]methyl]phenyl]phenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 67870742 |
| Molecular Formula | C30H33FN6 |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | 5-[2-[4-[[4-fluoro-5-(3-methylbutyl)-3-(2-phenylethyl)-2H-imidazol-1-yl]methyl]phenyl]phenyl]-2H-tetrazole |
| SMILES | CC(C)CCC1=C(F)N(CCc2ccccc2)CN1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C30H33FN6/c1-22(2)12-17-28-29(31)36(19-18-23-8-4-3-5-9-23)21-37(28)20-24-13-15-25(16-14-24)26-10-6-7-11-27(26)30-32-34-35-33-30/h3-11,13-16,22H,12,17-21H2,1-2H3,(H,32,33,34,35) |
| InChIKey | SDNMWEYUGTXDOA-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|