C27H36N6O2 — CID 67910520
5-[2-[4-[[4-(dimethoxymethyl)-3-ethyl-5-(3-methylbutyl)-2H-imidazol-1-yl]methyl]phenyl]phenyl]-2H-tetrazole (PubChem CID 67910520) has the molecular formula C27H36N6O2 and a molecular weight of 476.63 g/mol. Its IUPAC name is 5-[2-[4-[[4-(dimethoxymethyl)-3-ethyl-5-(3-methylbutyl)-2H-imidazol-1-yl]methyl]phenyl]phenyl]-2H-tetrazole.
| Compound Name | 5-[2-[4-[[4-(dimethoxymethyl)-3-ethyl-5-(3-methylbutyl)-2H-imidazol-1-yl]methyl]phenyl]phenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 67910520 |
| Molecular Formula | C27H36N6O2 |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | 5-[2-[4-[[4-(dimethoxymethyl)-3-ethyl-5-(3-methylbutyl)-2H-imidazol-1-yl]methyl]phenyl]phenyl]-2H-tetrazole |
| SMILES | CCN1CN(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)C(CCC(C)C)=C1C(OC)OC |
| InChI | InChI=1S/C27H36N6O2/c1-6-32-18-33(24(16-11-19(2)3)25(32)27(34-4)35-5)17-20-12-14-21(15-13-20)22-9-7-8-10-23(22)26-28-30-31-29-26/h7-10,12-15,19,27H,6,11,16-18H2,1-5H3,(H,28,29,30,31) |
| InChIKey | ZPQJHPQNQNWOAK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 79.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|