C28H38N6O2 — CID 67871181
5-[2-[4-[[5-butyl-3-tert-butyl-4-(dimethoxymethyl)-2H-imidazol-1-yl]methyl]phenyl]phenyl]-2H-tetrazole (PubChem CID 67871181) has the molecular formula C28H38N6O2 and a molecular weight of 490.65 g/mol. Its IUPAC name is 5-[2-[4-[[5-butyl-3-tert-butyl-4-(dimethoxymethyl)-2H-imidazol-1-yl]methyl]phenyl]phenyl]-2H-tetrazole.
| Compound Name | 5-[2-[4-[[5-butyl-3-tert-butyl-4-(dimethoxymethyl)-2H-imidazol-1-yl]methyl]phenyl]phenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 67871181 |
| Molecular Formula | C28H38N6O2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | 5-[2-[4-[[5-butyl-3-tert-butyl-4-(dimethoxymethyl)-2H-imidazol-1-yl]methyl]phenyl]phenyl]-2H-tetrazole |
| SMILES | CCCCC1=C(C(OC)OC)N(C(C)(C)C)CN1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C28H38N6O2/c1-7-8-13-24-25(27(35-5)36-6)34(28(2,3)4)19-33(24)18-20-14-16-21(17-15-20)22-11-9-10-12-23(22)26-29-31-32-30-26/h9-12,14-17,27H,7-8,13,18-19H2,1-6H3,(H,29,30,31,32) |
| InChIKey | VWPTVFCLOUIHLK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 79.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|