C21H28ClN3O4 — CID 67870763
6-chloro-8-methyl-7-[2-(4-methylpiperazin-2-yl)ethoxy]-2-morpholin-4-ylchromen-4-one (PubChem CID 67870763) has the molecular formula C21H28ClN3O4 and a molecular weight of 421.93 g/mol. Its IUPAC name is 6-chloro-8-methyl-7-[2-(4-methylpiperazin-2-yl)ethoxy]-2-morpholin-4-ylchromen-4-one.
| Compound Name | 6-chloro-8-methyl-7-[2-(4-methylpiperazin-2-yl)ethoxy]-2-morpholin-4-ylchromen-4-one |
|---|---|
| PubChem CID | 67870763 |
| Molecular Formula | C21H28ClN3O4 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 6-chloro-8-methyl-7-[2-(4-methylpiperazin-2-yl)ethoxy]-2-morpholin-4-ylchromen-4-one |
| SMILES | Cc1c(OCCC2CN(C)CCN2)c(Cl)cc2c(=O)cc(N3CCOCC3)oc12 |
| InChI | InChI=1S/C21H28ClN3O4/c1-14-20-16(18(26)12-19(29-20)25-6-9-27-10-7-25)11-17(22)21(14)28-8-3-15-13-24(2)5-4-23-15/h11-12,15,23H,3-10,13H2,1-2H3 |
| InChIKey | HITXBAUJLLIASW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 67.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |