C26H33N5O4 — CID 67871097
8-[2-[4-[3-(ethylamino)-2-pyridinyl]piperazin-2-yl]ethoxy]-2-morpholin-4-ylchromen-4-one (PubChem CID 67871097) has the molecular formula C26H33N5O4 and a molecular weight of 479.58 g/mol. Its IUPAC name is 8-[2-[4-[3-(ethylamino)-2-pyridinyl]piperazin-2-yl]ethoxy]-2-morpholin-4-ylchromen-4-one.
| Compound Name | 8-[2-[4-[3-(ethylamino)-2-pyridinyl]piperazin-2-yl]ethoxy]-2-morpholin-4-ylchromen-4-one |
|---|---|
| PubChem CID | 67871097 |
| Molecular Formula | C26H33N5O4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | 8-[2-[4-[3-(ethylamino)-2-pyridinyl]piperazin-2-yl]ethoxy]-2-morpholin-4-ylchromen-4-one |
| SMILES | CCNc1cccnc1N1CCNC(CCOc2cccc3c(=O)cc(N4CCOCC4)oc23)C1 |
| InChI | InChI=1S/C26H33N5O4/c1-2-27-21-6-4-9-29-26(21)31-11-10-28-19(18-31)8-14-34-23-7-3-5-20-22(32)17-24(35-25(20)23)30-12-15-33-16-13-30/h3-7,9,17,19,27-28H,2,8,10-16,18H2,1H3 |
| InChIKey | XPFIDUBJHQGUPG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 92.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |