C26H33N5O4 — CID 21460220
8-[2-[4-[3-(ethylamino)-2-pyridinyl]piperazin-1-yl]ethoxy]-2-morpholin-4-ylchromen-4-one (PubChem CID 21460220) has the molecular formula C26H33N5O4 and a molecular weight of 479.58 g/mol. Its IUPAC name is 8-[2-[4-[3-(ethylamino)-2-pyridinyl]piperazin-1-yl]ethoxy]-2-morpholin-4-ylchromen-4-one.
| Compound Name | 8-[2-[4-[3-(ethylamino)-2-pyridinyl]piperazin-1-yl]ethoxy]-2-morpholin-4-ylchromen-4-one |
|---|---|
| PubChem CID | 21460220 |
| Molecular Formula | C26H33N5O4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | 8-[2-[4-[3-(ethylamino)-2-pyridinyl]piperazin-1-yl]ethoxy]-2-morpholin-4-ylchromen-4-one |
| SMILES | CCNc1cccnc1N1CCN(CCOc2cccc3c(=O)cc(N4CCOCC4)oc23)CC1 |
| InChI | InChI=1S/C26H33N5O4/c1-2-27-21-6-4-8-28-26(21)31-11-9-29(10-12-31)13-18-34-23-7-3-5-20-22(32)19-24(35-25(20)23)30-14-16-33-17-15-30/h3-8,19,27H,2,9-18H2,1H3 |
| InChIKey | WLCGZUGGELMOHT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |