C21H26N2O5 — CID 21460116
N-cyclohexyl-2-(2-morpholin-4-yl-4-oxochromen-8-yl)oxyacetamide (PubChem CID 21460116) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-cyclohexyl-2-(2-morpholin-4-yl-4-oxochromen-8-yl)oxyacetamide.
| Compound Name | N-cyclohexyl-2-(2-morpholin-4-yl-4-oxochromen-8-yl)oxyacetamide |
|---|---|
| PubChem CID | 21460116 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-cyclohexyl-2-(2-morpholin-4-yl-4-oxochromen-8-yl)oxyacetamide |
| SMILES | O=C(COc1cccc2c(=O)cc(N3CCOCC3)oc12)NC1CCCCC1 |
| InChI | InChI=1S/C21H26N2O5/c24-17-13-20(23-9-11-26-12-10-23)28-21-16(17)7-4-8-18(21)27-14-19(25)22-15-5-2-1-3-6-15/h4,7-8,13,15H,1-3,5-6,9-12,14H2,(H,22,25) |
| InChIKey | NQRGLOWEAKEGFT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |