C32H32N2O6 — CID 11956211
2-[4-(2-morpholin-4-yl-4-oxochromen-8-yl)-2-phenylphenoxy]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 11956211) has the molecular formula C32H32N2O6 and a molecular weight of 540.62 g/mol. Its IUPAC name is 2-[4-(2-morpholin-4-yl-4-oxochromen-8-yl)-2-phenylphenoxy]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[4-(2-morpholin-4-yl-4-oxochromen-8-yl)-2-phenylphenoxy]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 11956211 |
| Molecular Formula | C32H32N2O6 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 2-[4-(2-morpholin-4-yl-4-oxochromen-8-yl)-2-phenylphenoxy]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | O=C(COc1ccc(-c2cccc3c(=O)cc(N4CCOCC4)oc23)cc1-c1ccccc1)NCC1CCCO1 |
| InChI | InChI=1S/C32H32N2O6/c35-28-19-31(34-13-16-37-17-14-34)40-32-25(9-4-10-26(28)32)23-11-12-29(27(18-23)22-6-2-1-3-7-22)39-21-30(36)33-20-24-8-5-15-38-24/h1-4,6-7,9-12,18-19,24H,5,8,13-17,20-21H2,(H,33,36) |
| InChIKey | REIXCLHLOVZRQO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |