C27H21NO6S — CID 59752265
2-[4-(2-morpholin-4-yl-4-oxochromen-8-yl)dibenzothiophen-1-yl]oxyacetic acid (PubChem CID 59752265) has the molecular formula C27H21NO6S and a molecular weight of 487.53 g/mol. Its IUPAC name is 2-[4-(2-morpholin-4-yl-4-oxochromen-8-yl)dibenzothiophen-1-yl]oxyacetic acid.
| Compound Name | 2-[4-(2-morpholin-4-yl-4-oxochromen-8-yl)dibenzothiophen-1-yl]oxyacetic acid |
|---|---|
| PubChem CID | 59752265 |
| Molecular Formula | C27H21NO6S |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 2-[4-(2-morpholin-4-yl-4-oxochromen-8-yl)dibenzothiophen-1-yl]oxyacetic acid |
| SMILES | O=C(O)COc1ccc(-c2cccc3c(=O)cc(N4CCOCC4)oc23)c2sc3ccccc3c12 |
| InChI | InChI=1S/C27H21NO6S/c29-20-14-23(28-10-12-32-13-11-28)34-26-16(5-3-6-18(20)26)17-8-9-21(33-15-24(30)31)25-19-4-1-2-7-22(19)35-27(17)25/h1-9,14H,10-13,15H2,(H,30,31) |
| InChIKey | CWQALKKQYLRZOB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |