C35H38N4O5S — CID 71819014
N-[4-(2-morpholin-4-yl-4-oxochromen-8-yl)dibenzothiophen-1-yl]-3-(3-morpholin-4-ylpropylamino)propanamide (PubChem CID 71819014) has the molecular formula C35H38N4O5S and a molecular weight of 626.78 g/mol. Its IUPAC name is N-[4-(2-morpholin-4-yl-4-oxochromen-8-yl)dibenzothiophen-1-yl]-3-(3-morpholin-4-ylpropylamino)propanamide.
| Compound Name | N-[4-(2-morpholin-4-yl-4-oxochromen-8-yl)dibenzothiophen-1-yl]-3-(3-morpholin-4-ylpropylamino)propanamide |
|---|---|
| PubChem CID | 71819014 |
| Molecular Formula | C35H38N4O5S |
| Molecular Weight | 626.78 g/mol |
| Exact Mass | 626.26 |
| IUPAC Name | N-[4-(2-morpholin-4-yl-4-oxochromen-8-yl)dibenzothiophen-1-yl]-3-(3-morpholin-4-ylpropylamino)propanamide |
| SMILES | O=C(CCNCCCN1CCOCC1)Nc1ccc(-c2cccc3c(=O)cc(N4CCOCC4)oc23)c2sc3ccccc3c12 |
| InChI | InChI=1S/C35H38N4O5S/c40-29-23-32(39-17-21-43-22-18-39)44-34-24(6-3-7-26(29)34)25-9-10-28(33-27-5-1-2-8-30(27)45-35(25)33)37-31(41)11-13-36-12-4-14-38-15-19-42-20-16-38/h1-3,5-10,23,36H,4,11-22H2,(H,37,41) |
| InChIKey | WJFSDFGKTJQREP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.78 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|