C36H40N4O6S — CID 71818726
3-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]-N-[4-(2-morpholin-4-yl-4-oxochromen-8-yl)dibenzothiophen-1-yl]propanamide (PubChem CID 71818726) has the molecular formula C36H40N4O6S and a molecular weight of 656.81 g/mol. Its IUPAC name is 3-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]-N-[4-(2-morpholin-4-yl-4-oxochromen-8-yl)dibenzothiophen-1-yl]propanamide.
| Compound Name | 3-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]-N-[4-(2-morpholin-4-yl-4-oxochromen-8-yl)dibenzothiophen-1-yl]propanamide |
|---|---|
| PubChem CID | 71818726 |
| Molecular Formula | C36H40N4O6S |
| Molecular Weight | 656.81 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | 3-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]-N-[4-(2-morpholin-4-yl-4-oxochromen-8-yl)dibenzothiophen-1-yl]propanamide |
| SMILES | O=C(CCN1CCN(CCOCCO)CC1)Nc1ccc(-c2cccc3c(=O)cc(N4CCOCC4)oc23)c2sc3ccccc3c12 |
| InChI | InChI=1S/C36H40N4O6S/c41-19-23-45-20-16-39-14-12-38(13-15-39)11-10-32(43)37-29-9-8-26(36-34(29)28-4-1-2-7-31(28)47-36)25-5-3-6-27-30(42)24-33(46-35(25)27)40-17-21-44-22-18-40/h1-9,24,41H,10-23H2,(H,37,43) |
| InChIKey | MWPHIKVBDOYVMC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.81 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|