C25H18N3O3S+ — CID 58285123
4-(2-morpholin-4-yl-4-oxochromen-8-yl)dibenzothiophene-1-diazonium (PubChem CID 58285123) has the molecular formula C25H18N3O3S+ and a molecular weight of 440.50 g/mol. Its IUPAC name is 4-(2-morpholin-4-yl-4-oxochromen-8-yl)dibenzothiophene-1-diazonium.
| Compound Name | 4-(2-morpholin-4-yl-4-oxochromen-8-yl)dibenzothiophene-1-diazonium |
|---|---|
| PubChem CID | 58285123 |
| Molecular Formula | C25H18N3O3S+ |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 4-(2-morpholin-4-yl-4-oxochromen-8-yl)dibenzothiophene-1-diazonium |
| SMILES | N#[N+]c1ccc(-c2cccc3c(=O)cc(N4CCOCC4)oc23)c2sc3ccccc3c12 |
| InChI | InChI=1S/C25H18N3O3S/c26-27-19-9-8-16(25-23(19)18-4-1-2-7-21(18)32-25)15-5-3-6-17-20(29)14-22(31-24(15)17)28-10-12-30-13-11-28/h1-9,14H,10-13H2/q+1 |
| InChIKey | CLYFRLQFIWDJJJ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|