C26H21NO3S — CID 54757057
8-(7-methyldibenzothiophen-4-yl)-2-morpholin-4-ylchromen-4-one (PubChem CID 54757057) has the molecular formula C26H21NO3S and a molecular weight of 427.53 g/mol. Its IUPAC name is 8-(7-methyldibenzothiophen-4-yl)-2-morpholin-4-ylchromen-4-one.
| Compound Name | 8-(7-methyldibenzothiophen-4-yl)-2-morpholin-4-ylchromen-4-one |
|---|---|
| PubChem CID | 54757057 |
| Molecular Formula | C26H21NO3S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 8-(7-methyldibenzothiophen-4-yl)-2-morpholin-4-ylchromen-4-one |
| SMILES | Cc1ccc2c(c1)sc1c(-c3cccc4c(=O)cc(N5CCOCC5)oc34)cccc12 |
| InChI | InChI=1S/C26H21NO3S/c1-16-8-9-17-19-5-3-6-20(26(19)31-23(17)14-16)18-4-2-7-21-22(28)15-24(30-25(18)21)27-10-12-29-13-11-27/h2-9,14-15H,10-13H2,1H3 |
| InChIKey | ZYVRVIXMHHEPLZ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |