C25H19NO4S — CID 54757264
8-(9-hydroxydibenzothiophen-4-yl)-2-morpholin-4-ylchromen-4-one (PubChem CID 54757264) has the molecular formula C25H19NO4S and a molecular weight of 429.50 g/mol. Its IUPAC name is 8-(9-hydroxydibenzothiophen-4-yl)-2-morpholin-4-ylchromen-4-one.
| Compound Name | 8-(9-hydroxydibenzothiophen-4-yl)-2-morpholin-4-ylchromen-4-one |
|---|---|
| PubChem CID | 54757264 |
| Molecular Formula | C25H19NO4S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 8-(9-hydroxydibenzothiophen-4-yl)-2-morpholin-4-ylchromen-4-one |
| SMILES | O=c1cc(N2CCOCC2)oc2c(-c3cccc4c3sc3cccc(O)c34)cccc12 |
| InChI | InChI=1S/C25H19NO4S/c27-19-8-3-9-21-23(19)18-7-2-5-16(25(18)31-21)15-4-1-6-17-20(28)14-22(30-24(15)17)26-10-12-29-13-11-26/h1-9,14,27H,10-13H2 |
| InChIKey | CGVPDTJMCOFUMC-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |