C27H21ClN2O4S — CID 59752259
2-chloro-N-[4-(2-morpholin-4-yl-4-oxochromen-8-yl)dibenzothiophen-1-yl]acetamide (PubChem CID 59752259) has the molecular formula C27H21ClN2O4S and a molecular weight of 505.00 g/mol. Its IUPAC name is 2-chloro-N-[4-(2-morpholin-4-yl-4-oxochromen-8-yl)dibenzothiophen-1-yl]acetamide.
| Compound Name | 2-chloro-N-[4-(2-morpholin-4-yl-4-oxochromen-8-yl)dibenzothiophen-1-yl]acetamide |
|---|---|
| PubChem CID | 59752259 |
| Molecular Formula | C27H21ClN2O4S |
| Molecular Weight | 505.00 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | 2-chloro-N-[4-(2-morpholin-4-yl-4-oxochromen-8-yl)dibenzothiophen-1-yl]acetamide |
| SMILES | O=C(CCl)Nc1ccc(-c2cccc3c(=O)cc(N4CCOCC4)oc23)c2sc3ccccc3c12 |
| InChI | InChI=1S/C27H21ClN2O4S/c28-15-23(32)29-20-9-8-17(27-25(20)19-4-1-2-7-22(19)35-27)16-5-3-6-18-21(31)14-24(34-26(16)18)30-10-12-33-13-11-30/h1-9,14H,10-13,15H2,(H,29,32) |
| InChIKey | OSDQVUMJADIKID-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.00 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|