C15H21N5S — CID 67871463
1-(4-methylphenyl)-4-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]piperazine (PubChem CID 67871463) has the molecular formula C15H21N5S and a molecular weight of 303.44 g/mol. Its IUPAC name is 1-(4-methylphenyl)-4-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]piperazine.
| Compound Name | 1-(4-methylphenyl)-4-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]piperazine |
|---|---|
| PubChem CID | 67871463 |
| Molecular Formula | C15H21N5S |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 1-(4-methylphenyl)-4-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]piperazine |
| SMILES | Cc1ccc(N2CCN(CCSc3ncn[nH]3)CC2)cc1 |
| InChI | InChI=1S/C15H21N5S/c1-13-2-4-14(5-3-13)20-8-6-19(7-9-20)10-11-21-15-16-12-17-18-15/h2-5,12H,6-11H2,1H3,(H,16,17,18) |
| InChIKey | YWAIKNPHSVZRDO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|