C17H22BrNO — CID 67873213
2-bromo-N,N-dicyclopentylbenzamide (PubChem CID 67873213) has the molecular formula C17H22BrNO and a molecular weight of 336.27 g/mol. Its IUPAC name is 2-bromo-N,N-dicyclopentylbenzamide.
| Compound Name | 2-bromo-N,N-dicyclopentylbenzamide |
|---|---|
| PubChem CID | 67873213 |
| Molecular Formula | C17H22BrNO |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-bromo-N,N-dicyclopentylbenzamide |
| SMILES | O=C(c1ccccc1Br)N(C1CCCC1)C1CCCC1 |
| InChI | InChI=1S/C17H22BrNO/c18-16-12-6-5-11-15(16)17(20)19(13-7-1-2-8-13)14-9-3-4-10-14/h5-6,11-14H,1-4,7-10H2 |
| InChIKey | MMEXHBGGJIGVND-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |