C15H20BrNOS — CID 60619670
3-bromo-N,N-dicyclopentylthiophene-2-carboxamide (PubChem CID 60619670) has the molecular formula C15H20BrNOS and a molecular weight of 342.30 g/mol. Its IUPAC name is 3-bromo-N,N-dicyclopentylthiophene-2-carboxamide.
| Compound Name | 3-bromo-N,N-dicyclopentylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 60619670 |
| Molecular Formula | C15H20BrNOS |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 3-bromo-N,N-dicyclopentylthiophene-2-carboxamide |
| SMILES | O=C(c1sccc1Br)N(C1CCCC1)C1CCCC1 |
| InChI | InChI=1S/C15H20BrNOS/c16-13-9-10-19-14(13)15(18)17(11-5-1-2-6-11)12-7-3-4-8-12/h9-12H,1-8H2 |
| InChIKey | FPNDOJHSNSTVHV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |