C11H13BrN2OS2 — CID 55240299
N-(3-amino-3-sulfanylidenepropyl)-3-bromo-N-cyclopropylthiophene-2-carboxamide (PubChem CID 55240299) has the molecular formula C11H13BrN2OS2 and a molecular weight of 333.28 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-3-bromo-N-cyclopropylthiophene-2-carboxamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-3-bromo-N-cyclopropylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55240299 |
| Molecular Formula | C11H13BrN2OS2 |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-3-bromo-N-cyclopropylthiophene-2-carboxamide |
| SMILES | NC(=S)CCN(C(=O)c1sccc1Br)C1CC1 |
| InChI | InChI=1S/C11H13BrN2OS2/c12-8-4-6-17-10(8)11(15)14(7-1-2-7)5-3-9(13)16/h4,6-7H,1-3,5H2,(H2,13,16) |
| InChIKey | SRYFDIQZBJAAOB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|