C13H14BrClN2OS — CID 107987768
N-(3-amino-3-sulfanylidenepropyl)-2-bromo-4-chloro-N-cyclopropylbenzamide (PubChem CID 107987768) has the molecular formula C13H14BrClN2OS and a molecular weight of 361.69 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-2-bromo-4-chloro-N-cyclopropylbenzamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-2-bromo-4-chloro-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 107987768 |
| Molecular Formula | C13H14BrClN2OS |
| Molecular Weight | 361.69 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-2-bromo-4-chloro-N-cyclopropylbenzamide |
| SMILES | NC(=S)CCN(C(=O)c1ccc(Cl)cc1Br)C1CC1 |
| InChI | InChI=1S/C13H14BrClN2OS/c14-11-7-8(15)1-4-10(11)13(18)17(9-2-3-9)6-5-12(16)19/h1,4,7,9H,2-3,5-6H2,(H2,16,19) |
| InChIKey | MZUQSKKKULEJJT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.69 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|