C13H13ClF2N2OS — CID 82771439
N-(3-amino-3-sulfanylidenepropyl)-4-chloro-N-cyclopropyl-2,5-difluorobenzamide (PubChem CID 82771439) has the molecular formula C13H13ClF2N2OS and a molecular weight of 318.78 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-4-chloro-N-cyclopropyl-2,5-difluorobenzamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-4-chloro-N-cyclopropyl-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 82771439 |
| Molecular Formula | C13H13ClF2N2OS |
| Molecular Weight | 318.78 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-4-chloro-N-cyclopropyl-2,5-difluorobenzamide |
| SMILES | NC(=S)CCN(C(=O)c1cc(F)c(Cl)cc1F)C1CC1 |
| InChI | InChI=1S/C13H13ClF2N2OS/c14-9-6-10(15)8(5-11(9)16)13(19)18(7-1-2-7)4-3-12(17)20/h5-7H,1-4H2,(H2,17,20) |
| InChIKey | JSNDSIVBVRBJBW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.78 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|