C14H13ClF2N2O — CID 82771438
4-chloro-N-(cyanomethyl)-N-cyclopentyl-2,5-difluorobenzamide (PubChem CID 82771438) has the molecular formula C14H13ClF2N2O and a molecular weight of 298.72 g/mol. Its IUPAC name is 4-chloro-N-(cyanomethyl)-N-cyclopentyl-2,5-difluorobenzamide.
| Compound Name | 4-chloro-N-(cyanomethyl)-N-cyclopentyl-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 82771438 |
| Molecular Formula | C14H13ClF2N2O |
| Molecular Weight | 298.72 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 4-chloro-N-(cyanomethyl)-N-cyclopentyl-2,5-difluorobenzamide |
| SMILES | N#CCN(C(=O)c1cc(F)c(Cl)cc1F)C1CCCC1 |
| InChI | InChI=1S/C14H13ClF2N2O/c15-11-8-12(16)10(7-13(11)17)14(20)19(6-5-18)9-3-1-2-4-9/h7-9H,1-4,6H2 |
| InChIKey | PQJUMDGYXIUKSJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.72 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|