C26H32N2O6 — CID 67873444
tert-butyl (2R)-2-[(2-methoxy-2-oxoethyl)-(1-methoxy-2-phenylethyl)carbamoyl]-2,3-dihydroindole-1-carboxylate (PubChem CID 67873444) has the molecular formula C26H32N2O6 and a molecular weight of 468.55 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(2-methoxy-2-oxoethyl)-(1-methoxy-2-phenylethyl)carbamoyl]-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(2-methoxy-2-oxoethyl)-(1-methoxy-2-phenylethyl)carbamoyl]-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 67873444 |
| Molecular Formula | C26H32N2O6 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | tert-butyl (2R)-2-[(2-methoxy-2-oxoethyl)-(1-methoxy-2-phenylethyl)carbamoyl]-2,3-dihydroindole-1-carboxylate |
| SMILES | COC(=O)CN(C(=O)[C@H]1Cc2ccccc2N1C(=O)OC(C)(C)C)C(Cc1ccccc1)OC |
| InChI | InChI=1S/C26H32N2O6/c1-26(2,3)34-25(31)28-20-14-10-9-13-19(20)16-21(28)24(30)27(17-23(29)33-5)22(32-4)15-18-11-7-6-8-12-18/h6-14,21-22H,15-17H2,1-5H3/t21-,22?/m1/s1 |
| InChIKey | JEYATGJQSQLYKD-ZMFCMNQTSA-N |
| XLogP | 3.57 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|