C25H30N2O6 — CID 69213827
tert-butyl (2S)-2-[2-[4-(2-methoxy-2-oxoethyl)phenoxy]ethylcarbamoyl]-2,3-dihydroindole-1-carboxylate (PubChem CID 69213827) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is tert-butyl (2S)-2-[2-[4-(2-methoxy-2-oxoethyl)phenoxy]ethylcarbamoyl]-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[2-[4-(2-methoxy-2-oxoethyl)phenoxy]ethylcarbamoyl]-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 69213827 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | tert-butyl (2S)-2-[2-[4-(2-methoxy-2-oxoethyl)phenoxy]ethylcarbamoyl]-2,3-dihydroindole-1-carboxylate |
| SMILES | COC(=O)Cc1ccc(OCCNC(=O)[C@@H]2Cc3ccccc3N2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H30N2O6/c1-25(2,3)33-24(30)27-20-8-6-5-7-18(20)16-21(27)23(29)26-13-14-32-19-11-9-17(10-12-19)15-22(28)31-4/h5-12,21H,13-16H2,1-4H3,(H,26,29)/t21-/m0/s1 |
| InChIKey | GJZUXSUBDGWOAW-NRFANRHFSA-N |
| XLogP | 3.26 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|