C11H11ClN2 — CID 67873575
1-chloro-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline (PubChem CID 67873575) has the molecular formula C11H11ClN2 and a molecular weight of 206.68 g/mol. Its IUPAC name is 1-chloro-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline.
| Compound Name | 1-chloro-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline |
|---|---|
| PubChem CID | 67873575 |
| Molecular Formula | C11H11ClN2 |
| Molecular Weight | 206.68 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 1-chloro-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline |
| SMILES | ClC1CCC2N=c3ccccc3=CN12 |
| InChI | InChI=1S/C11H11ClN2/c12-10-5-6-11-13-9-4-2-1-3-8(9)7-14(10)11/h1-4,7,10-11H,5-6H2 |
| InChIKey | CJKLOFFMPABATE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.68 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|