About 2-methyl-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline
2-methyl-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline (PubChem CID 57374606) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is 2-methyl-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline.
Analyze 2-methyl-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline?
The IUPAC name of 2-methyl-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline (CID 57374606) is 2-methyl-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline.
What is the SMILES notation for 2-methyl-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline?
The canonical SMILES for 2-methyl-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline is CC1CC2N=c3ccccc3=CN2C1.
What is the InChIKey of 2-methyl-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline?
The InChIKey is UIMKANXAGBZYBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-9-6-12-13-11-5-3-2-4-10(11)8-14(12)7-9/h2-5,8-9,12H,6-7H2,1H3.
What are the key properties of 2-methyl-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline?
2-methyl-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline has a molecular weight of 186.26 g/mol, XLogP of 0.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline is sourced from PubChem (CID 57374606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).