C13H16N2 — CID 54441439
2-methyl-2-pyrrolidin-1-ylindole (PubChem CID 54441439) has the molecular formula C13H16N2 and a molecular weight of 200.29 g/mol. Its IUPAC name is 2-methyl-2-pyrrolidin-1-ylindole.
| Compound Name | 2-methyl-2-pyrrolidin-1-ylindole |
|---|---|
| PubChem CID | 54441439 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-methyl-2-pyrrolidin-1-ylindole |
| SMILES | CC1(N2CCCC2)C=c2ccccc2=N1 |
| InChI | InChI=1S/C13H16N2/c1-13(15-8-4-5-9-15)10-11-6-2-3-7-12(11)14-13/h2-3,6-7,10H,4-5,8-9H2,1H3 |
| InChIKey | WOJKNWGHFZMPMB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |