C13H22N2 — CID 143715536
ethane;3-methyl-5-propan-2-yl-2,3a-dihydrobenzimidazole (PubChem CID 143715536) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is ethane;3-methyl-5-propan-2-yl-2,3a-dihydrobenzimidazole.
| Compound Name | ethane;3-methyl-5-propan-2-yl-2,3a-dihydrobenzimidazole |
|---|---|
| PubChem CID | 143715536 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | ethane;3-methyl-5-propan-2-yl-2,3a-dihydrobenzimidazole |
| SMILES | CC.CC(C)C1=CC2C(=NCN2C)C=C1 |
| InChI | InChI=1S/C11H16N2.C2H6/c1-8(2)9-4-5-10-11(6-9)13(3)7-12-10;1-2/h4-6,8,11H,7H2,1-3H3;1-2H3 |
| InChIKey | BMURIPOVLLIZEZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |