C23H29N3 — CID 144569188
2-[(1E,3Z)-cycloocta-1,3,6-trien-1-yl]-3-(6-methyl-2,3-dihydropyridin-2-yl)-2,3a-dihydrobenzimidazole;ethane (PubChem CID 144569188) has the molecular formula C23H29N3 and a molecular weight of 347.51 g/mol. Its IUPAC name is 2-[(1E,3Z)-cycloocta-1,3,6-trien-1-yl]-3-(6-methyl-2,3-dihydropyridin-2-yl)-2,3a-dihydrobenzimidazole;ethane.
| Compound Name | 2-[(1E,3Z)-cycloocta-1,3,6-trien-1-yl]-3-(6-methyl-2,3-dihydropyridin-2-yl)-2,3a-dihydrobenzimidazole;ethane |
|---|---|
| PubChem CID | 144569188 |
| Molecular Formula | C23H29N3 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | 2-[(1E,3Z)-cycloocta-1,3,6-trien-1-yl]-3-(6-methyl-2,3-dihydropyridin-2-yl)-2,3a-dihydrobenzimidazole;ethane |
| SMILES | CC.CC1=NC(N2C3C=CC=CC3=NC2/C2=C/C=C\CC=CC2)CC=C1 |
| InChI | InChI=1S/C21H23N3.C2H6/c1-16-10-9-15-20(22-16)24-19-14-8-7-13-18(19)23-21(24)17-11-5-3-2-4-6-12-17;1-2/h3-11,13-14,19-21H,2,12,15H2,1H3;1-2H3/b5-3-,6-4?,17-11+; |
| InChIKey | BFOYTSRBXOMSJG-GWCNYYAFSA-N |
| XLogP | 5.17 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|