C17H19N3 — CID 20661818
2-methyl-1,3-bis(prop-2-enyl)-3a,9a-dihydropyrrolo[3,2-b]quinoxaline (PubChem CID 20661818) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-methyl-1,3-bis(prop-2-enyl)-3a,9a-dihydropyrrolo[3,2-b]quinoxaline.
| Compound Name | 2-methyl-1,3-bis(prop-2-enyl)-3a,9a-dihydropyrrolo[3,2-b]quinoxaline |
|---|---|
| PubChem CID | 20661818 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 2-methyl-1,3-bis(prop-2-enyl)-3a,9a-dihydropyrrolo[3,2-b]quinoxaline |
| SMILES | C=CCC1=C(C)N(CC=C)C2N=c3ccccc3=NC12 |
| InChI | InChI=1S/C17H19N3/c1-4-8-13-12(3)20(11-5-2)17-16(13)18-14-9-6-7-10-15(14)19-17/h4-7,9-10,16-17H,1-2,8,11H2,3H3 |
| InChIKey | YYFWWLLTGKRIOQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|