C12H14N4O6 — CID 67873642
2-(N-[2-[(2-aminoacetyl)amino]acetyl]-4-nitroanilino)acetic acid (PubChem CID 67873642) has the molecular formula C12H14N4O6 and a molecular weight of 310.27 g/mol. Its IUPAC name is 2-(N-[2-[(2-aminoacetyl)amino]acetyl]-4-nitroanilino)acetic acid.
| Compound Name | 2-(N-[2-[(2-aminoacetyl)amino]acetyl]-4-nitroanilino)acetic acid |
|---|---|
| PubChem CID | 67873642 |
| Molecular Formula | C12H14N4O6 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-(N-[2-[(2-aminoacetyl)amino]acetyl]-4-nitroanilino)acetic acid |
| SMILES | NCC(=O)NCC(=O)N(CC(=O)O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H14N4O6/c13-5-10(17)14-6-11(18)15(7-12(19)20)8-1-3-9(4-2-8)16(21)22/h1-4H,5-7,13H2,(H,14,17)(H,19,20) |
| InChIKey | JPENQFQELVBFLV-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 155.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|