C20H33ClNO2+ — CID 67875919
2-[2-(4-chlorophenyl)acetyl]oxyethyl-dimethyl-octylazanium (PubChem CID 67875919) has the molecular formula C20H33ClNO2+ and a molecular weight of 354.94 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)acetyl]oxyethyl-dimethyl-octylazanium.
| Compound Name | 2-[2-(4-chlorophenyl)acetyl]oxyethyl-dimethyl-octylazanium |
|---|---|
| PubChem CID | 67875919 |
| Molecular Formula | C20H33ClNO2+ |
| Molecular Weight | 354.94 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 2-[2-(4-chlorophenyl)acetyl]oxyethyl-dimethyl-octylazanium |
| SMILES | CCCCCCCC[N+](C)(C)CCOC(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H33ClNO2/c1-4-5-6-7-8-9-14-22(2,3)15-16-24-20(23)17-18-10-12-19(21)13-11-18/h10-13H,4-9,14-17H2,1-3H3/q+1 |
| InChIKey | DCFFGLSZUXWXPJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.94 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|