About butane;3-oxo-3-(4-propylcyclohexyl)oxypropanoic acid
butane;3-oxo-3-(4-propylcyclohexyl)oxypropanoic acid (PubChem CID 67876933) has the molecular formula C16H30O4
and a molecular weight of 286.41 g/mol. Its IUPAC name is butane;3-oxo-3-(4-propylcyclohexyl)oxypropanoic acid.
Molecular Properties
| Compound Name | butane;3-oxo-3-(4-propylcyclohexyl)oxypropanoic acid |
| PubChem CID | 67876933 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | butane;3-oxo-3-(4-propylcyclohexyl)oxypropanoic acid |
| SMILES | CCCC.CCCC1CCC(OC(=O)CC(=O)O)CC1 |
| InChI | InChI=1S/C12H20O4.C4H10/c1-2-3-9-4-6-10(7-5-9)16-12(15)8-11(13)14;1-3-4-2/h9-10H,2-8H2,1H3,(H,13,14);3-4H2,1-2H3 |
| InChIKey | OSYPOWYVOOTTBP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze butane;3-oxo-3-(4-propylcyclohexyl)oxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;3-oxo-3-(4-propylcyclohexyl)oxypropanoic acid?
The IUPAC name of butane;3-oxo-3-(4-propylcyclohexyl)oxypropanoic acid (CID 67876933) is butane;3-oxo-3-(4-propylcyclohexyl)oxypropanoic acid.
What is the SMILES notation for butane;3-oxo-3-(4-propylcyclohexyl)oxypropanoic acid?
The canonical SMILES for butane;3-oxo-3-(4-propylcyclohexyl)oxypropanoic acid is CCCC.CCCC1CCC(OC(=O)CC(=O)O)CC1.
What is the InChIKey of butane;3-oxo-3-(4-propylcyclohexyl)oxypropanoic acid?
The InChIKey is OSYPOWYVOOTTBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4.C4H10/c1-2-3-9-4-6-10(7-5-9)16-12(15)8-11(13)14;1-3-4-2/h9-10H,2-8H2,1H3,(H,13,14);3-4H2,1-2H3.
What are the key properties of butane;3-oxo-3-(4-propylcyclohexyl)oxypropanoic acid?
butane;3-oxo-3-(4-propylcyclohexyl)oxypropanoic acid has a molecular weight of 286.41 g/mol, XLogP of 4.17, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane;3-oxo-3-(4-propylcyclohexyl)oxypropanoic acid is sourced from PubChem (CID 67876933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).