C22H28N4O6 — CID 67880533
(2S)-1-[2-(4-nitroimidazol-1-yl)octanoyl]-4-phenoxypyrrolidine-2-carboxylic acid (PubChem CID 67880533) has the molecular formula C22H28N4O6 and a molecular weight of 444.49 g/mol. Its IUPAC name is (2S)-1-[2-(4-nitroimidazol-1-yl)octanoyl]-4-phenoxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-(4-nitroimidazol-1-yl)octanoyl]-4-phenoxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 67880533 |
| Molecular Formula | C22H28N4O6 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (2S)-1-[2-(4-nitroimidazol-1-yl)octanoyl]-4-phenoxypyrrolidine-2-carboxylic acid |
| SMILES | CCCCCCC(C(=O)N1CC(Oc2ccccc2)C[C@H]1C(=O)O)n1cnc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H28N4O6/c1-2-3-4-8-11-18(24-14-20(23-15-24)26(30)31)21(27)25-13-17(12-19(25)22(28)29)32-16-9-6-5-7-10-16/h5-7,9-10,14-15,17-19H,2-4,8,11-13H2,1H3,(H,28,29)/t17?,18?,19-/m0/s1 |
| InChIKey | BUMYJHFMDHCNJH-ACBHZAAOSA-N |
| XLogP | 3.44 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|