C21H24ClNO3 — CID 67884292
1-(1-benzofuran-7-yloxy)-1-(1,2,3,4-tetrahydronaphthalen-2-ylamino)propan-2-ol;hydrochloride (PubChem CID 67884292) has the molecular formula C21H24ClNO3 and a molecular weight of 373.88 g/mol. Its IUPAC name is 1-(1-benzofuran-7-yloxy)-1-(1,2,3,4-tetrahydronaphthalen-2-ylamino)propan-2-ol;hydrochloride.
| Compound Name | 1-(1-benzofuran-7-yloxy)-1-(1,2,3,4-tetrahydronaphthalen-2-ylamino)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 67884292 |
| Molecular Formula | C21H24ClNO3 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1-(1-benzofuran-7-yloxy)-1-(1,2,3,4-tetrahydronaphthalen-2-ylamino)propan-2-ol;hydrochloride |
| SMILES | CC(O)C(NC1CCc2ccccc2C1)Oc1cccc2ccoc12.Cl |
| InChI | InChI=1S/C21H23NO3.ClH/c1-14(23)21(25-19-8-4-7-16-11-12-24-20(16)19)22-18-10-9-15-5-2-3-6-17(15)13-18;/h2-8,11-12,14,18,21-23H,9-10,13H2,1H3;1H |
| InChIKey | VBPLJKZEQNBLHJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|