C28H43N3O5 — CID 67884831
1-[(2S)-6-amino-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]hexanoyl]-3,3a,4,5,6,7,8,8a-octahydro-2H-cyclohepta[b]pyrrole-2-carboxylic acid (PubChem CID 67884831) has the molecular formula C28H43N3O5 and a molecular weight of 501.67 g/mol. Its IUPAC name is 1-[(2S)-6-amino-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]hexanoyl]-3,3a,4,5,6,7,8,8a-octahydro-2H-cyclohepta[b]pyrrole-2-carboxylic acid.
| Compound Name | 1-[(2S)-6-amino-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]hexanoyl]-3,3a,4,5,6,7,8,8a-octahydro-2H-cyclohepta[b]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 67884831 |
| Molecular Formula | C28H43N3O5 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.32 |
| IUPAC Name | 1-[(2S)-6-amino-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]hexanoyl]-3,3a,4,5,6,7,8,8a-octahydro-2H-cyclohepta[b]pyrrole-2-carboxylic acid |
| SMILES | CCOC(=O)C(CCc1ccccc1)N[C@@H](CCCCN)C(=O)N1C(C(=O)O)CC2CCCCCC21 |
| InChI | InChI=1S/C28H43N3O5/c1-2-36-28(35)23(17-16-20-11-5-3-6-12-20)30-22(14-9-10-18-29)26(32)31-24-15-8-4-7-13-21(24)19-25(31)27(33)34/h3,5-6,11-12,21-25,30H,2,4,7-10,13-19,29H2,1H3,(H,33,34)/t21?,22-,23?,24?,25?/m0/s1 |
| InChIKey | LOSOISKFZQCQBO-UPYHTJOQSA-N |
| XLogP | 3.27 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|